C13H8F3N3S — CID 170560489
N-[3-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 170560489) has the molecular formula C13H8F3N3S and a molecular weight of 295.29 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[3-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170560489 |
| Molecular Formula | C13H8F3N3S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-[3-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cccc(Nc2ncnc3ccsc23)c1 |
| InChI | InChI=1S/C13H8F3N3S/c14-13(15,16)8-2-1-3-9(6-8)19-12-11-10(4-5-20-11)17-7-18-12/h1-7H,(H,17,18,19) |
| InChIKey | BWYAMNUTGDFWHS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |