C13H9N3OS — CID 167084503
3-(thieno[3,2-d]pyrimidin-4-ylamino)benzaldehyde (PubChem CID 167084503) has the molecular formula C13H9N3OS and a molecular weight of 255.30 g/mol. Its IUPAC name is 3-(thieno[3,2-d]pyrimidin-4-ylamino)benzaldehyde.
| Compound Name | 3-(thieno[3,2-d]pyrimidin-4-ylamino)benzaldehyde |
|---|---|
| PubChem CID | 167084503 |
| Molecular Formula | C13H9N3OS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 3-(thieno[3,2-d]pyrimidin-4-ylamino)benzaldehyde |
| SMILES | O=Cc1cccc(Nc2ncnc3ccsc23)c1 |
| InChI | InChI=1S/C13H9N3OS/c17-7-9-2-1-3-10(6-9)16-13-12-11(4-5-18-12)14-8-15-13/h1-8H,(H,14,15,16) |
| InChIKey | YQGSLANBQYKRKN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|