C14H11N3OS — CID 17422025
1-[3-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]ethanone (PubChem CID 17422025) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is 1-[3-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]ethanone.
| Compound Name | 1-[3-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 17422025 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 1-[3-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2ncnc3ccsc23)c1 |
| InChI | InChI=1S/C14H11N3OS/c1-9(18)10-3-2-4-11(7-10)17-14-13-12(5-6-19-13)15-8-16-14/h2-8H,1H3,(H,15,16,17) |
| InChIKey | YGRCEVYBHACGKC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |