C24H21N5O3 — CID 44569443
1-(3-acetylphenyl)-3-[4-(3-methoxyanilino)quinazolin-6-yl]urea (PubChem CID 44569443) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[4-(3-methoxyanilino)quinazolin-6-yl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[4-(3-methoxyanilino)quinazolin-6-yl]urea |
|---|---|
| PubChem CID | 44569443 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[4-(3-methoxyanilino)quinazolin-6-yl]urea |
| SMILES | COc1cccc(Nc2ncnc3ccc(NC(=O)Nc4cccc(C(C)=O)c4)cc23)c1 |
| InChI | InChI=1S/C24H21N5O3/c1-15(30)16-5-3-6-17(11-16)28-24(31)29-19-9-10-22-21(13-19)23(26-14-25-22)27-18-7-4-8-20(12-18)32-2/h3-14H,1-2H3,(H,25,26,27)(H2,28,29,31) |
| InChIKey | ZECCXNZTZYMXQE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |