C17H17ClN4O — CID 166972075
6-N-(2-chloroethyl)-4-N-(3-methoxyphenyl)quinazoline-4,6-diamine (PubChem CID 166972075) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 6-N-(2-chloroethyl)-4-N-(3-methoxyphenyl)quinazoline-4,6-diamine.
| Compound Name | 6-N-(2-chloroethyl)-4-N-(3-methoxyphenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 166972075 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 6-N-(2-chloroethyl)-4-N-(3-methoxyphenyl)quinazoline-4,6-diamine |
| SMILES | COc1cccc(Nc2ncnc3ccc(NCCCl)cc23)c1 |
| InChI | InChI=1S/C17H17ClN4O/c1-23-14-4-2-3-13(9-14)22-17-15-10-12(19-8-7-18)5-6-16(15)20-11-21-17/h2-6,9-11,19H,7-8H2,1H3,(H,20,21,22) |
| InChIKey | XMLZRFXOYPBHHW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|