C17H14ClN3O — CID 18925055
N-(3-ethynylphenyl)-6-methoxyquinazolin-4-amine;hydrochloride (PubChem CID 18925055) has the molecular formula C17H14ClN3O and a molecular weight of 311.77 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6-methoxyquinazolin-4-amine;hydrochloride.
| Compound Name | N-(3-ethynylphenyl)-6-methoxyquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 18925055 |
| Molecular Formula | C17H14ClN3O |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-(3-ethynylphenyl)-6-methoxyquinazolin-4-amine;hydrochloride |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(OC)cc23)c1.Cl |
| InChI | InChI=1S/C17H13N3O.ClH/c1-3-12-5-4-6-13(9-12)20-17-15-10-14(21-2)7-8-16(15)18-11-19-17;/h1,4-11H,2H3,(H,18,19,20);1H |
| InChIKey | HMKJWRGRNHPARW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|