C28H25Cl2N5O4 — CID 162132329
4-chloro-6,7-dimethoxyquinazoline;N-(3-ethynylphenyl)-6,7-dimethoxyquinazolin-4-amine;hydrochloride (PubChem CID 162132329) has the molecular formula C28H25Cl2N5O4 and a molecular weight of 566.45 g/mol. Its IUPAC name is 4-chloro-6,7-dimethoxyquinazoline;N-(3-ethynylphenyl)-6,7-dimethoxyquinazolin-4-amine;hydrochloride.
| Compound Name | 4-chloro-6,7-dimethoxyquinazoline;N-(3-ethynylphenyl)-6,7-dimethoxyquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 162132329 |
| Molecular Formula | C28H25Cl2N5O4 |
| Molecular Weight | 566.45 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | 4-chloro-6,7-dimethoxyquinazoline;N-(3-ethynylphenyl)-6,7-dimethoxyquinazolin-4-amine;hydrochloride |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OC)cc23)c1.COc1cc2ncnc(Cl)c2cc1OC.Cl |
| InChI | InChI=1S/C18H15N3O2.C10H9ClN2O2.ClH/c1-4-12-6-5-7-13(8-12)21-18-14-9-16(22-2)17(23-3)10-15(14)19-11-20-18;1-14-8-3-6-7(4-9(8)15-2)12-5-13-10(6)11;/h1,5-11H,2-3H3,(H,19,20,21);3-5H,1-2H3;1H |
| InChIKey | ZIVBXOKNNJLMBX-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|