C41H40N6O8 — CID 87387764
2-[4-(3-ethynylanilino)-7-(2-hydroxyethoxy)quinazolin-6-yl]oxyethanol;2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethanol (PubChem CID 87387764) has the molecular formula C41H40N6O8 and a molecular weight of 744.81 g/mol. Its IUPAC name is 2-[4-(3-ethynylanilino)-7-(2-hydroxyethoxy)quinazolin-6-yl]oxyethanol;2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethanol.
| Compound Name | 2-[4-(3-ethynylanilino)-7-(2-hydroxyethoxy)quinazolin-6-yl]oxyethanol;2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethanol |
|---|---|
| PubChem CID | 87387764 |
| Molecular Formula | C41H40N6O8 |
| Molecular Weight | 744.81 g/mol |
| Exact Mass | 744.29 |
| IUPAC Name | 2-[4-(3-ethynylanilino)-7-(2-hydroxyethoxy)quinazolin-6-yl]oxyethanol;2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethanol |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCO)c(OCCO)cc23)c1.C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCO)cc23)c1 |
| InChI | InChI=1S/C21H21N3O4.C20H19N3O4/c1-3-15-5-4-6-16(11-15)24-21-17-12-19(27-8-7-25)20(28-10-9-26-2)13-18(17)22-14-23-21;1-2-14-4-3-5-15(10-14)23-20-16-11-18(26-8-6-24)19(27-9-7-25)12-17(16)21-13-22-20/h1,4-6,11-14,25H,7-10H2,2H3,(H,22,23,24);1,3-5,10-13,24-25H,6-9H2,(H,21,22,23) |
| InChIKey | MGJWBPCHCILQAR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 182.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.81 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|