C26H33N3O3 — CID 154677880
ethane;N-(3-ethynylphenyl)-7-(2-methoxyethoxy)-6-(3-methylbutoxy)quinazolin-4-amine (PubChem CID 154677880) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is ethane;N-(3-ethynylphenyl)-7-(2-methoxyethoxy)-6-(3-methylbutoxy)quinazolin-4-amine.
| Compound Name | ethane;N-(3-ethynylphenyl)-7-(2-methoxyethoxy)-6-(3-methylbutoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 154677880 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | ethane;N-(3-ethynylphenyl)-7-(2-methoxyethoxy)-6-(3-methylbutoxy)quinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCC(C)C)cc23)c1.CC |
| InChI | InChI=1S/C24H27N3O3.C2H6/c1-5-18-7-6-8-19(13-18)27-24-20-14-22(29-10-9-17(2)3)23(30-12-11-28-4)15-21(20)25-16-26-24;1-2/h1,6-8,13-17H,9-12H2,2-4H3,(H,25,26,27);1-2H3 |
| InChIKey | LPDSJDLVEWGWTM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|