C29H30N3O7S- — CID 86640911
N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;4-methylbenzenesulfonate (PubChem CID 86640911) has the molecular formula C29H30N3O7S- and a molecular weight of 564.64 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;4-methylbenzenesulfonate.
| Compound Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86640911 |
| Molecular Formula | C29H30N3O7S- |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;4-methylbenzenesulfonate |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C22H23N3O4.C7H8O3S/c1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22;1-6-2-4-7(5-3-6)11(8,9)10/h1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25);2-5H,1H3,(H,8,9,10)/p-1 |
| InChIKey | XUPNDGCKDFRETL-UHFFFAOYSA-M |
| XLogP | 4.30 |
| TPSA | 131.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|