C23H23N3O5S — CID 18925075
2-[2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethylsulfanyl]acetic acid (PubChem CID 18925075) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 18925075 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-[2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethylsulfanyl]acetic acid |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCSCC(=O)O)cc23)c1 |
| InChI | InChI=1S/C23H23N3O5S/c1-3-16-5-4-6-17(11-16)26-23-18-12-20(31-9-10-32-14-22(27)28)21(30-8-7-29-2)13-19(18)24-15-25-23/h1,4-6,11-13,15H,7-10,14H2,2H3,(H,27,28)(H,24,25,26) |
| InChIKey | SFWHHCANOAGOCF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|