C24H23N5O3 — CID 18925101
N-(3-ethynylphenyl)-7-(2-imidazol-1-ylethoxy)-6-(2-methoxyethoxy)quinazolin-4-amine (PubChem CID 18925101) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-7-(2-imidazol-1-ylethoxy)-6-(2-methoxyethoxy)quinazolin-4-amine.
| Compound Name | N-(3-ethynylphenyl)-7-(2-imidazol-1-ylethoxy)-6-(2-methoxyethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 18925101 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-(3-ethynylphenyl)-7-(2-imidazol-1-ylethoxy)-6-(2-methoxyethoxy)quinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCn4ccnc4)c(OCCOC)cc23)c1 |
| InChI | InChI=1S/C24H23N5O3/c1-3-18-5-4-6-19(13-18)28-24-20-14-22(32-12-11-30-2)23(15-21(20)26-16-27-24)31-10-9-29-8-7-25-17-29/h1,4-8,13-17H,9-12H2,2H3,(H,26,27,28) |
| InChIKey | UVECCWRFEADVDJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|