C22H21N3O5 — CID 175022699
2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethyl formate (PubChem CID 175022699) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is 2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethyl formate.
| Compound Name | 2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethyl formate |
|---|---|
| PubChem CID | 175022699 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxyethyl formate |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC=O)cc23)c1 |
| InChI | InChI=1S/C22H21N3O5/c1-3-16-5-4-6-17(11-16)25-22-18-12-20(30-10-8-28-15-26)21(29-9-7-27-2)13-19(18)23-14-24-22/h1,4-6,11-15H,7-10H2,2H3,(H,23,24,25) |
| InChIKey | IOSZTCXBEITVJU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|