C22H19F4N3O4 — CID 122446160
6,7-bis[2-(difluoromethoxy)ethoxy]-N-(3-ethynylphenyl)quinazolin-4-amine (PubChem CID 122446160) has the molecular formula C22H19F4N3O4 and a molecular weight of 465.40 g/mol. Its IUPAC name is 6,7-bis[2-(difluoromethoxy)ethoxy]-N-(3-ethynylphenyl)quinazolin-4-amine.
| Compound Name | 6,7-bis[2-(difluoromethoxy)ethoxy]-N-(3-ethynylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 122446160 |
| Molecular Formula | C22H19F4N3O4 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 6,7-bis[2-(difluoromethoxy)ethoxy]-N-(3-ethynylphenyl)quinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC(F)F)c(OCCOC(F)F)cc23)c1 |
| InChI | InChI=1S/C22H19F4N3O4/c1-2-14-4-3-5-15(10-14)29-20-16-11-18(30-6-8-32-21(23)24)19(12-17(16)27-13-28-20)31-7-9-33-22(25)26/h1,3-5,10-13,21-22H,6-9H2,(H,27,28,29) |
| InChIKey | VATGIYDOHRBFMD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|