C20H18ClF4N3O4 — CID 122485483
N-(3-chlorophenyl)-6,7-bis[2-(difluoromethoxy)ethoxy]quinazolin-4-amine (PubChem CID 122485483) has the molecular formula C20H18ClF4N3O4 and a molecular weight of 475.83 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6,7-bis[2-(difluoromethoxy)ethoxy]quinazolin-4-amine.
| Compound Name | N-(3-chlorophenyl)-6,7-bis[2-(difluoromethoxy)ethoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 122485483 |
| Molecular Formula | C20H18ClF4N3O4 |
| Molecular Weight | 475.83 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-(3-chlorophenyl)-6,7-bis[2-(difluoromethoxy)ethoxy]quinazolin-4-amine |
| SMILES | FC(F)OCCOc1cc2ncnc(Nc3cccc(Cl)c3)c2cc1OCCOC(F)F |
| InChI | InChI=1S/C20H18ClF4N3O4/c21-12-2-1-3-13(8-12)28-18-14-9-16(29-4-6-31-19(22)23)17(10-15(14)26-11-27-18)30-5-7-32-20(24)25/h1-3,8-11,19-20H,4-7H2,(H,26,27,28) |
| InChIKey | ILZJKNLQGQSUCK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.83 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|