C20H22ClN3O4 — CID 139073723
N-(4-chlorophenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine (PubChem CID 139073723) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine.
| Compound Name | N-(4-chlorophenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 139073723 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-(4-chlorophenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(Cl)cc3)c2cc1OCCOC |
| InChI | InChI=1S/C20H22ClN3O4/c1-25-7-9-27-18-11-16-17(12-19(18)28-10-8-26-2)22-13-23-20(16)24-15-5-3-14(21)4-6-15/h3-6,11-13H,7-10H2,1-2H3,(H,22,23,24) |
| InChIKey | WUZMHPOFEKILPW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|