C23H25N3O4 — CID 143713379
6-(2-ethoxyethoxy)-N-(4-ethynylphenyl)-7-(2-methoxyethoxy)quinazolin-4-amine (PubChem CID 143713379) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 6-(2-ethoxyethoxy)-N-(4-ethynylphenyl)-7-(2-methoxyethoxy)quinazolin-4-amine.
| Compound Name | 6-(2-ethoxyethoxy)-N-(4-ethynylphenyl)-7-(2-methoxyethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 143713379 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 6-(2-ethoxyethoxy)-N-(4-ethynylphenyl)-7-(2-methoxyethoxy)quinazolin-4-amine |
| SMILES | C#Cc1ccc(Nc2ncnc3cc(OCCOC)c(OCCOCC)cc23)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-4-17-6-8-18(9-7-17)26-23-19-14-21(30-13-11-28-5-2)22(29-12-10-27-3)15-20(19)24-16-25-23/h1,6-9,14-16H,5,10-13H2,2-3H3,(H,24,25,26) |
| InChIKey | FXUPTSSUJATNLR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|