C22H23N3O5 — CID 177371613
3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-5-ethynylphenol (PubChem CID 177371613) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-5-ethynylphenol.
| Compound Name | 3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-5-ethynylphenol |
|---|---|
| PubChem CID | 177371613 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-5-ethynylphenol |
| SMILES | C#Cc1cc(O)cc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1 |
| InChI | InChI=1S/C22H23N3O5/c1-4-15-9-16(11-17(26)10-15)25-22-18-12-20(29-7-5-27-2)21(30-8-6-28-3)13-19(18)23-14-24-22/h1,9-14,26H,5-8H2,2-3H3,(H,23,24,25) |
| InChIKey | JKSQYZRONXUCGD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|