C20H24N4O4 — CID 171420006
4-N-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]benzene-1,4-diamine (PubChem CID 171420006) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-N-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 171420006 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 4-N-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]benzene-1,4-diamine |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(N)cc3)c2cc1OCCOC |
| InChI | InChI=1S/C20H24N4O4/c1-25-7-9-27-18-11-16-17(12-19(18)28-10-8-26-2)22-13-23-20(16)24-15-5-3-14(21)4-6-15/h3-6,11-13H,7-10,21H2,1-2H3,(H,22,23,24) |
| InChIKey | NSTLGPQMKUEIOZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|