C21H27N3O9P2 — CID 10301892
[[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 10301892) has the molecular formula C21H27N3O9P2 and a molecular weight of 527.41 g/mol. Its IUPAC name is [[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 10301892 |
| Molecular Formula | C21H27N3O9P2 |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | [[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(P(=O)(O)CP(=O)(O)O)cc3)c2cc1OCCOC |
| InChI | InChI=1S/C21H27N3O9P2/c1-30-7-9-32-19-11-17-18(12-20(19)33-10-8-31-2)22-13-23-21(17)24-15-3-5-16(6-4-15)34(25,26)14-35(27,28)29/h3-6,11-13H,7-10,14H2,1-2H3,(H,25,26)(H,22,23,24)(H2,27,28,29) |
| InChIKey | GMWHPXAPPJSHSG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 169.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|