C22H26ClN3O3 — CID 142929534
1-[4-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]phenyl]ethanone;ethane (PubChem CID 142929534) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is 1-[4-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]phenyl]ethanone;ethane.
| Compound Name | 1-[4-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]phenyl]ethanone;ethane |
|---|---|
| PubChem CID | 142929534 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-[4-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]phenyl]ethanone;ethane |
| SMILES | CC.COc1cc2c(Nc3ccc(C(C)=O)cc3)ncnc2cc1OCCCCl |
| InChI | InChI=1S/C20H20ClN3O3.C2H6/c1-13(25)14-4-6-15(7-5-14)24-20-16-10-18(26-2)19(27-9-3-8-21)11-17(16)22-12-23-20;1-2/h4-7,10-12H,3,8-9H2,1-2H3,(H,22,23,24);1-2H3 |
| InChIKey | RQEZBLPCTJGCFJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|