C17H18ClN5O4 — CID 68983330
[5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-3-yl] acetate (PubChem CID 68983330) has the molecular formula C17H18ClN5O4 and a molecular weight of 391.82 g/mol. Its IUPAC name is [5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-3-yl] acetate.
| Compound Name | [5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-3-yl] acetate |
|---|---|
| PubChem CID | 68983330 |
| Molecular Formula | C17H18ClN5O4 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-3-yl] acetate |
| SMILES | COc1cc2c(Nc3cc(OC(C)=O)n[nH]3)ncnc2cc1OCCCCl |
| InChI | InChI=1S/C17H18ClN5O4/c1-10(24)27-16-8-15(22-23-16)21-17-11-6-13(25-2)14(26-5-3-4-18)7-12(11)19-9-20-17/h6-9H,3-5H2,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | ZYSVDRDSLWDMLI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|