C18H16Cl2FN3O2 — CID 10982156
N-(4-chloro-2-fluorophenyl)-7-(3-chloropropoxy)-6-methoxyquinazolin-4-amine (PubChem CID 10982156) has the molecular formula C18H16Cl2FN3O2 and a molecular weight of 396.25 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-7-(3-chloropropoxy)-6-methoxyquinazolin-4-amine.
| Compound Name | N-(4-chloro-2-fluorophenyl)-7-(3-chloropropoxy)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 10982156 |
| Molecular Formula | C18H16Cl2FN3O2 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-7-(3-chloropropoxy)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Cl)cc3F)ncnc2cc1OCCCCl |
| InChI | InChI=1S/C18H16Cl2FN3O2/c1-25-16-8-12-15(9-17(16)26-6-2-5-19)22-10-23-18(12)24-14-4-3-11(20)7-13(14)21/h3-4,7-10H,2,5-6H2,1H3,(H,22,23,24) |
| InChIKey | RNMLLLSSOQJENX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|