C21H21ClFN3O4 — CID 22478301
ethyl 4-[4-(4-chloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxybutanoate (PubChem CID 22478301) has the molecular formula C21H21ClFN3O4 and a molecular weight of 433.87 g/mol. Its IUPAC name is ethyl 4-[4-(4-chloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxybutanoate.
| Compound Name | ethyl 4-[4-(4-chloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxybutanoate |
|---|---|
| PubChem CID | 22478301 |
| Molecular Formula | C21H21ClFN3O4 |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | ethyl 4-[4-(4-chloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxybutanoate |
| SMILES | CCOC(=O)CCCOc1cc2ncnc(Nc3ccc(Cl)cc3F)c2cc1OC |
| InChI | InChI=1S/C21H21ClFN3O4/c1-3-29-20(27)5-4-8-30-19-11-17-14(10-18(19)28-2)21(25-12-24-17)26-16-7-6-13(22)9-15(16)23/h6-7,9-12H,3-5,8H2,1-2H3,(H,24,25,26) |
| InChIKey | DEBQBWXZCXSFBF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|