C26H31ClFN3O5 — CID 69009484
ethyl 7-[4-(3-chloro-4-fluoroanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyheptanoate (PubChem CID 69009484) has the molecular formula C26H31ClFN3O5 and a molecular weight of 520.00 g/mol. Its IUPAC name is ethyl 7-[4-(3-chloro-4-fluoroanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyheptanoate.
| Compound Name | ethyl 7-[4-(3-chloro-4-fluoroanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyheptanoate |
|---|---|
| PubChem CID | 69009484 |
| Molecular Formula | C26H31ClFN3O5 |
| Molecular Weight | 520.00 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | ethyl 7-[4-(3-chloro-4-fluoroanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyheptanoate |
| SMILES | CCOC(=O)CCCCCCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCOC |
| InChI | InChI=1S/C26H31ClFN3O5/c1-3-34-25(32)8-6-4-5-7-11-35-24-16-22-19(15-23(24)36-13-12-33-2)26(30-17-29-22)31-18-9-10-21(28)20(27)14-18/h9-10,14-17H,3-8,11-13H2,1-2H3,(H,29,30,31) |
| InChIKey | ZXDNPOLVQMDHCF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.00 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|