C22H23ClFN3O4 — CID 58172592
7-[4-(3-chloro-4-fluoroanilino)-6-methoxyquinazolin-7-yl]oxy-1-hydroxyheptan-2-one (PubChem CID 58172592) has the molecular formula C22H23ClFN3O4 and a molecular weight of 447.89 g/mol. Its IUPAC name is 7-[4-(3-chloro-4-fluoroanilino)-6-methoxyquinazolin-7-yl]oxy-1-hydroxyheptan-2-one.
| Compound Name | 7-[4-(3-chloro-4-fluoroanilino)-6-methoxyquinazolin-7-yl]oxy-1-hydroxyheptan-2-one |
|---|---|
| PubChem CID | 58172592 |
| Molecular Formula | C22H23ClFN3O4 |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 7-[4-(3-chloro-4-fluoroanilino)-6-methoxyquinazolin-7-yl]oxy-1-hydroxyheptan-2-one |
| SMILES | COc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCCCCC(=O)CO |
| InChI | InChI=1S/C22H23ClFN3O4/c1-30-20-10-16-19(11-21(20)31-8-4-2-3-5-15(29)12-28)25-13-26-22(16)27-14-6-7-18(24)17(23)9-14/h6-7,9-11,13,28H,2-5,8,12H2,1H3,(H,25,26,27) |
| InChIKey | RYGUJAHKXJVXNA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|