C22H24ClFN4O2 — CID 19077516
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine (PubChem CID 19077516) has the molecular formula C22H24ClFN4O2 and a molecular weight of 430.91 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 19077516 |
| Molecular Formula | C22H24ClFN4O2 |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C22H24ClFN4O2/c1-29-20-13-19-16(12-21(20)30-10-4-9-28-7-2-3-8-28)22(26-14-25-19)27-15-5-6-18(24)17(23)11-15/h5-6,11-14H,2-4,7-10H2,1H3,(H,25,26,27) |
| InChIKey | XGPAXWVNLWKLEF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|