C25H30ClFN4O2 — CID 72544473
N-(3-chloro-4-fluorophenyl)-6-[3-[(2R)-2-ethylpiperidin-1-yl]propoxy]-7-methoxyquinazolin-4-amine (PubChem CID 72544473) has the molecular formula C25H30ClFN4O2 and a molecular weight of 472.99 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-[3-[(2R)-2-ethylpiperidin-1-yl]propoxy]-7-methoxyquinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-[3-[(2R)-2-ethylpiperidin-1-yl]propoxy]-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 72544473 |
| Molecular Formula | C25H30ClFN4O2 |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-[3-[(2R)-2-ethylpiperidin-1-yl]propoxy]-7-methoxyquinazolin-4-amine |
| SMILES | CC[C@@H]1CCCCN1CCCOc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC |
| InChI | InChI=1S/C25H30ClFN4O2/c1-3-18-7-4-5-10-31(18)11-6-12-33-24-14-19-22(15-23(24)32-2)28-16-29-25(19)30-17-8-9-21(27)20(26)13-17/h8-9,13-16,18H,3-7,10-12H2,1-2H3,(H,28,29,30)/t18-/m1/s1 |
| InChIKey | BALZGIHJPCZXHM-GOSISDBHSA-N |
| XLogP | 6.21 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|