C24H27ClFN5O2 — CID 25253583
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(6-methyl-2,6-diazabicyclo[2.2.1]heptan-2-yl)propoxy]quinazolin-4-amine (PubChem CID 25253583) has the molecular formula C24H27ClFN5O2 and a molecular weight of 471.96 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(6-methyl-2,6-diazabicyclo[2.2.1]heptan-2-yl)propoxy]quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(6-methyl-2,6-diazabicyclo[2.2.1]heptan-2-yl)propoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 25253583 |
| Molecular Formula | C24H27ClFN5O2 |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(6-methyl-2,6-diazabicyclo[2.2.1]heptan-2-yl)propoxy]quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCN1CC2CC1N(C)C2 |
| InChI | InChI=1S/C24H27ClFN5O2/c1-30-12-15-8-23(30)31(13-15)6-3-7-33-22-10-17-20(11-21(22)32-2)27-14-28-24(17)29-16-4-5-19(26)18(25)9-16/h4-5,9-11,14-15,23H,3,6-8,12-13H2,1-2H3,(H,27,28,29) |
| InChIKey | LNIZGDWDFTUUCV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|