C23H26ClFN4O3 — CID 25252963
[(2S)-1-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]pyrrolidin-2-yl]methanol (PubChem CID 25252963) has the molecular formula C23H26ClFN4O3 and a molecular weight of 460.94 g/mol. Its IUPAC name is [(2S)-1-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 25252963 |
| Molecular Formula | C23H26ClFN4O3 |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | [(2S)-1-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]pyrrolidin-2-yl]methanol |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCN1CCC[C@H]1CO |
| InChI | InChI=1S/C23H26ClFN4O3/c1-31-21-12-20-17(11-22(21)32-9-3-8-29-7-2-4-16(29)13-30)23(27-14-26-20)28-15-5-6-19(25)18(24)10-15/h5-6,10-12,14,16,30H,2-4,7-9,13H2,1H3,(H,26,27,28)/t16-/m0/s1 |
| InChIKey | CFLKUNXNGFTVPE-INIZCTEOSA-N |
| XLogP | 4.40 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|