C25H31ClFN5O2 — CID 167060447
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]quinazolin-4-amine (PubChem CID 167060447) has the molecular formula C25H31ClFN5O2 and a molecular weight of 488.01 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 167060447 |
| Molecular Formula | C25H31ClFN5O2 |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCN1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C25H31ClFN5O2/c1-17(2)32-10-8-31(9-11-32)7-4-12-34-24-14-19-22(15-23(24)33-3)28-16-29-25(19)30-18-5-6-21(27)20(26)13-18/h5-6,13-17H,4,7-12H2,1-3H3,(H,28,29,30) |
| InChIKey | MXXRAGGUOPYCFC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|