C26H32ClFN4O5 — CID 71584867
butanoic acid;N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine (PubChem CID 71584867) has the molecular formula C26H32ClFN4O5 and a molecular weight of 535.02 g/mol. Its IUPAC name is butanoic acid;N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine.
| Compound Name | butanoic acid;N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 71584867 |
| Molecular Formula | C26H32ClFN4O5 |
| Molecular Weight | 535.02 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | butanoic acid;N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
| SMILES | CCCC(=O)O.COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C22H24ClFN4O3.C4H8O2/c1-29-20-13-19-16(12-21(20)31-8-2-5-28-6-9-30-10-7-28)22(26-14-25-19)27-15-3-4-18(24)17(23)11-15;1-2-3-4(5)6/h3-4,11-14H,2,5-10H2,1H3,(H,25,26,27);2-3H2,1H3,(H,5,6) |
| InChIKey | PQIQOIGISDIQLJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.02 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|