C25H30ClFN4O3 — CID 141320482
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(6-morpholin-4-ylhexoxy)quinazolin-4-amine (PubChem CID 141320482) has the molecular formula C25H30ClFN4O3 and a molecular weight of 488.99 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(6-morpholin-4-ylhexoxy)quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(6-morpholin-4-ylhexoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 141320482 |
| Molecular Formula | C25H30ClFN4O3 |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(6-morpholin-4-ylhexoxy)quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCCCCN1CCOCC1 |
| InChI | InChI=1S/C25H30ClFN4O3/c1-32-23-16-22-19(25(29-17-28-22)30-18-6-7-21(27)20(26)14-18)15-24(23)34-11-5-3-2-4-8-31-9-12-33-13-10-31/h6-7,14-17H,2-5,8-13H2,1H3,(H,28,29,30) |
| InChIKey | FYYPDEXYLPOHPX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|