C27H33ClFN5O2 — CID 71571663
N-(3-chloro-4-fluorophenyl)-6-[3-(6-ethyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl)propoxy]-7-methoxyquinazolin-4-amine (PubChem CID 71571663) has the molecular formula C27H33ClFN5O2 and a molecular weight of 514.05 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-[3-(6-ethyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl)propoxy]-7-methoxyquinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-[3-(6-ethyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl)propoxy]-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 71571663 |
| Molecular Formula | C27H33ClFN5O2 |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-[3-(6-ethyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl)propoxy]-7-methoxyquinazolin-4-amine |
| SMILES | CCN1CCC2CCN(CCCOc3cc4c(Nc5ccc(F)c(Cl)c5)ncnc4cc3OC)C2C1 |
| InChI | InChI=1S/C27H33ClFN5O2/c1-3-33-10-7-18-8-11-34(24(18)16-33)9-4-12-36-26-14-20-23(15-25(26)35-2)30-17-31-27(20)32-19-5-6-22(29)21(28)13-19/h5-6,13-15,17-18,24H,3-4,7-12,16H2,1-2H3,(H,30,31,32) |
| InChIKey | KJNIPUBRDXDLHP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|