C27H32FN5O3 — CID 90337658
1-[1-[3-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]ethanone (PubChem CID 90337658) has the molecular formula C27H32FN5O3 and a molecular weight of 493.58 g/mol. Its IUPAC name is 1-[1-[3-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]ethanone.
| Compound Name | 1-[1-[3-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]ethanone |
|---|---|
| PubChem CID | 90337658 |
| Molecular Formula | C27H32FN5O3 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 1-[1-[3-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]ethanone |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(C)c3)c2cc1OCCCN1CCC2CN(C(C)=O)CC21 |
| InChI | InChI=1S/C27H32FN5O3/c1-17-11-20(5-6-22(17)28)31-27-21-12-26(25(35-3)13-23(21)29-16-30-27)36-10-4-8-32-9-7-19-14-33(18(2)34)15-24(19)32/h5-6,11-13,16,19,24H,4,7-10,14-15H2,1-3H3,(H,29,30,31) |
| InChIKey | MYRQFCTWTORVGC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|