C19H21FN4O2 — CID 156814297
6-(3-aminopropoxy)-N-(4-fluoro-3-methylphenyl)-7-methoxyquinazolin-4-amine (PubChem CID 156814297) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is 6-(3-aminopropoxy)-N-(4-fluoro-3-methylphenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-(3-aminopropoxy)-N-(4-fluoro-3-methylphenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 156814297 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 6-(3-aminopropoxy)-N-(4-fluoro-3-methylphenyl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(C)c3)c2cc1OCCCN |
| InChI | InChI=1S/C19H21FN4O2/c1-12-8-13(4-5-15(12)20)24-19-14-9-18(26-7-3-6-21)17(25-2)10-16(14)22-11-23-19/h4-5,8-11H,3,6-7,21H2,1-2H3,(H,22,23,24) |
| InChIKey | CDOGFVNJWIRFCS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|