C20H22FN3O2 — CID 165053338
N-(4-fluoro-3-methylphenyl)-7-methoxy-6-(2-methylpropoxy)quinazolin-4-amine (PubChem CID 165053338) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-7-methoxy-6-(2-methylpropoxy)quinazolin-4-amine.
| Compound Name | N-(4-fluoro-3-methylphenyl)-7-methoxy-6-(2-methylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 165053338 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-7-methoxy-6-(2-methylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(C)c3)c2cc1OCC(C)C |
| InChI | InChI=1S/C20H22FN3O2/c1-12(2)10-26-19-8-15-17(9-18(19)25-4)22-11-23-20(15)24-14-5-6-16(21)13(3)7-14/h5-9,11-12H,10H2,1-4H3,(H,22,23,24) |
| InChIKey | QAAVEUNMMVWSQW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |