C21H24FN3O2 — CID 164975823
[4-(4-fluoro-3-methylanilino)-6-(3-methylbutoxy)quinazolin-7-yl]methanol (PubChem CID 164975823) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is [4-(4-fluoro-3-methylanilino)-6-(3-methylbutoxy)quinazolin-7-yl]methanol.
| Compound Name | [4-(4-fluoro-3-methylanilino)-6-(3-methylbutoxy)quinazolin-7-yl]methanol |
|---|---|
| PubChem CID | 164975823 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [4-(4-fluoro-3-methylanilino)-6-(3-methylbutoxy)quinazolin-7-yl]methanol |
| SMILES | Cc1cc(Nc2ncnc3cc(CO)c(OCCC(C)C)cc23)ccc1F |
| InChI | InChI=1S/C21H24FN3O2/c1-13(2)6-7-27-20-10-17-19(9-15(20)11-26)23-12-24-21(17)25-16-4-5-18(22)14(3)8-16/h4-5,8-10,12-13,26H,6-7,11H2,1-3H3,(H,23,24,25) |
| InChIKey | DTLMAULSFSFQEU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |