C16H15N3O3 — CID 23569361
2-[[7-(hydroxymethyl)-6-methoxyquinazolin-4-yl]amino]phenol (PubChem CID 23569361) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[[7-(hydroxymethyl)-6-methoxyquinazolin-4-yl]amino]phenol.
| Compound Name | 2-[[7-(hydroxymethyl)-6-methoxyquinazolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 23569361 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[[7-(hydroxymethyl)-6-methoxyquinazolin-4-yl]amino]phenol |
| SMILES | COc1cc2c(Nc3ccccc3O)ncnc2cc1CO |
| InChI | InChI=1S/C16H15N3O3/c1-22-15-7-11-13(6-10(15)8-20)17-9-18-16(11)19-12-4-2-3-5-14(12)21/h2-7,9,20-21H,8H2,1H3,(H,17,18,19) |
| InChIKey | ABUXBIFWEDLEEJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|