C19H20ClN3O4 — CID 118112159
2-chloro-3-[[6-methoxy-7-(3-methoxypropoxy)quinazolin-4-yl]amino]phenol (PubChem CID 118112159) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-chloro-3-[[6-methoxy-7-(3-methoxypropoxy)quinazolin-4-yl]amino]phenol.
| Compound Name | 2-chloro-3-[[6-methoxy-7-(3-methoxypropoxy)quinazolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 118112159 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-chloro-3-[[6-methoxy-7-(3-methoxypropoxy)quinazolin-4-yl]amino]phenol |
| SMILES | COCCCOc1cc2ncnc(Nc3cccc(O)c3Cl)c2cc1OC |
| InChI | InChI=1S/C19H20ClN3O4/c1-25-7-4-8-27-17-10-14-12(9-16(17)26-2)19(22-11-21-14)23-13-5-3-6-15(24)18(13)20/h3,5-6,9-11,24H,4,7-8H2,1-2H3,(H,21,22,23) |
| InChIKey | BQXBUAJYWNQUFV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|