C21H25N3O6 — CID 11517241
6-methoxy-7-(2-methoxyethoxy)-N-(2,3,5-trimethoxyphenyl)quinazolin-4-amine (PubChem CID 11517241) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 6-methoxy-7-(2-methoxyethoxy)-N-(2,3,5-trimethoxyphenyl)quinazolin-4-amine.
| Compound Name | 6-methoxy-7-(2-methoxyethoxy)-N-(2,3,5-trimethoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 11517241 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 6-methoxy-7-(2-methoxyethoxy)-N-(2,3,5-trimethoxyphenyl)quinazolin-4-amine |
| SMILES | COCCOc1cc2ncnc(Nc3cc(OC)cc(OC)c3OC)c2cc1OC |
| InChI | InChI=1S/C21H25N3O6/c1-25-6-7-30-18-11-15-14(10-17(18)27-3)21(23-12-22-15)24-16-8-13(26-2)9-19(28-4)20(16)29-5/h8-12H,6-7H2,1-5H3,(H,22,23,24) |
| InChIKey | SRAGVLNVMVBPFH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|