C27H26N4O5 — CID 87870945
2-[2-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-5-(2-methylaziridin-1-yl)phenyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 87870945) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-[2-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-5-(2-methylaziridin-1-yl)phenyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[2-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-5-(2-methylaziridin-1-yl)phenyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 87870945 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-[2-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-5-(2-methylaziridin-1-yl)phenyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(N4CC4C)cc3C3=CC(=O)C=CC3=O)c2cc1OC |
| InChI | InChI=1S/C27H26N4O5/c1-16-14-31(16)17-4-6-22(19(10-17)20-11-18(32)5-7-24(20)33)30-27-21-12-25(35-3)26(36-9-8-34-2)13-23(21)28-15-29-27/h4-7,10-13,15-16H,8-9,14H2,1-3H3,(H,28,29,30) |
| InChIKey | UZOVQCHCKQDPQO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|