C26H23N3O8 — CID 11562471
2-(1,3-benzodioxol-5-ylmethoxy)-5-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 11562471) has the molecular formula C26H23N3O8 and a molecular weight of 505.48 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethoxy)-5-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethoxy)-5-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11562471 |
| Molecular Formula | C26H23N3O8 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethoxy)-5-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COCCOc1cc2ncnc(NC3=CC(=O)C(OCc4ccc5c(c4)OCO5)=CC3=O)c2cc1OC |
| InChI | InChI=1S/C26H23N3O8/c1-32-5-6-34-25-10-17-16(8-23(25)33-2)26(28-13-27-17)29-18-9-20(31)22(11-19(18)30)35-12-15-3-4-21-24(7-15)37-14-36-21/h3-4,7-11,13H,5-6,12,14H2,1-2H3,(H,27,28,29) |
| InChIKey | BPRXPQLUEGJSEZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|