C22H24N4O4 — CID 21002962
4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-6,7-dimethoxyquinazoline (PubChem CID 21002962) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-6,7-dimethoxyquinazoline.
| Compound Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-6,7-dimethoxyquinazoline |
|---|---|
| PubChem CID | 21002962 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2ncnc(N3CCN(Cc4ccc5c(c4)OCO5)CC3)c2cc1OC |
| InChI | InChI=1S/C22H24N4O4/c1-27-19-10-16-17(11-20(19)28-2)23-13-24-22(16)26-7-5-25(6-8-26)12-15-3-4-18-21(9-15)30-14-29-18/h3-4,9-11,13H,5-8,12,14H2,1-2H3 |
| InChIKey | OWTMYUYGJWDVMP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |