C21H23ClN4O2 — CID 177373905
4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6,7-dimethoxyquinazoline (PubChem CID 177373905) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6,7-dimethoxyquinazoline.
| Compound Name | 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6,7-dimethoxyquinazoline |
|---|---|
| PubChem CID | 177373905 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2ncnc(N3CCN(Cc4ccc(Cl)cc4)CC3)c2cc1OC |
| InChI | InChI=1S/C21H23ClN4O2/c1-27-19-11-17-18(12-20(19)28-2)23-14-24-21(17)26-9-7-25(8-10-26)13-15-3-5-16(22)6-4-15/h3-6,11-12,14H,7-10,13H2,1-2H3 |
| InChIKey | OCAZWKJIRZTXCJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |