C15H20N4O2 — CID 2808928
6,7-dimethoxy-4-(4-methylpiperazin-1-yl)quinazoline (PubChem CID 2808928) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 6,7-dimethoxy-4-(4-methylpiperazin-1-yl)quinazoline.
| Compound Name | 6,7-dimethoxy-4-(4-methylpiperazin-1-yl)quinazoline |
|---|---|
| PubChem CID | 2808928 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6,7-dimethoxy-4-(4-methylpiperazin-1-yl)quinazoline |
| SMILES | COc1cc2ncnc(N3CCN(C)CC3)c2cc1OC |
| InChI | InChI=1S/C15H20N4O2/c1-18-4-6-19(7-5-18)15-11-8-13(20-2)14(21-3)9-12(11)16-10-17-15/h8-10H,4-7H2,1-3H3 |
| InChIKey | ULBUABJAUQKQMH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |