C15H17N3O3 — CID 14738823
1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-one (PubChem CID 14738823) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-one.
| Compound Name | 1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-one |
|---|---|
| PubChem CID | 14738823 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-one |
| SMILES | COc1cc2ncnc(N3CCC(=O)CC3)c2cc1OC |
| InChI | InChI=1S/C15H17N3O3/c1-20-13-7-11-12(8-14(13)21-2)16-9-17-15(11)18-5-3-10(19)4-6-18/h7-9H,3-6H2,1-2H3 |
| InChIKey | PZHWXCGXKMISHV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |