C14H17N3O3 — CID 21487876
1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol (PubChem CID 21487876) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol.
| Compound Name | 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 21487876 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol |
| SMILES | COc1cc2ncnc(N3CCC(O)C3)c2cc1OC |
| InChI | InChI=1S/C14H17N3O3/c1-19-12-5-10-11(6-13(12)20-2)15-8-16-14(10)17-4-3-9(18)7-17/h5-6,8-9,18H,3-4,7H2,1-2H3 |
| InChIKey | UQPTYTXPUASFIN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |