About 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol
1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol (PubChem CID 21487876) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol |
| PubChem CID | 21487876 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol |
| SMILES | COc1cc2ncnc(N3CCC(O)C3)c2cc1OC |
| InChI | InChI=1S/C14H17N3O3/c1-19-12-5-10-11(6-13(12)20-2)15-8-16-14(10)17-4-3-9(18)7-17/h5-6,8-9,18H,3-4,7H2,1-2H3 |
| InChIKey | UQPTYTXPUASFIN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol?
The IUPAC name of 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol (CID 21487876) is 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol.
What is the SMILES notation for 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol?
The canonical SMILES for 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol is COc1cc2ncnc(N3CCC(O)C3)c2cc1OC.
What is the InChIKey of 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol?
The InChIKey is UQPTYTXPUASFIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c1-19-12-5-10-11(6-13(12)20-2)15-8-16-14(10)17-4-3-9(18)7-17/h5-6,8-9,18H,3-4,7H2,1-2H3.
What are the key properties of 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol?
1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol has a molecular weight of 275.31 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-ol is sourced from PubChem (CID 21487876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).