C19H24N4O3 — CID 165435283
N-cyclopropyl-1-(6,7-dimethoxyquinazolin-4-yl)piperidine-3-carboxamide (PubChem CID 165435283) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-cyclopropyl-1-(6,7-dimethoxyquinazolin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-(6,7-dimethoxyquinazolin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 165435283 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-cyclopropyl-1-(6,7-dimethoxyquinazolin-4-yl)piperidine-3-carboxamide |
| SMILES | COc1cc2ncnc(N3CCCC(C(=O)NC4CC4)C3)c2cc1OC |
| InChI | InChI=1S/C19H24N4O3/c1-25-16-8-14-15(9-17(16)26-2)20-11-21-18(14)23-7-3-4-12(10-23)19(24)22-13-5-6-13/h8-9,11-13H,3-7,10H2,1-2H3,(H,22,24) |
| InChIKey | SUEXXKWVKAANPU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |