C24H29N5O3 — CID 58770603
1-[1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-yl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 58770603) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 1-[1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-yl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-yl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 58770603 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-[1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-yl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | COc1cc2ncnc(N3CCC(NC(=O)Nc4ccc(C(C)C)cc4)C3)c2cc1OC |
| InChI | InChI=1S/C24H29N5O3/c1-15(2)16-5-7-17(8-6-16)27-24(30)28-18-9-10-29(13-18)23-19-11-21(31-3)22(32-4)12-20(19)25-14-26-23/h5-8,11-12,14-15,18H,9-10,13H2,1-4H3,(H2,27,28,30) |
| InChIKey | TZHWVFRWHYCRQK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |